C21H22ClN3O — CID 142729367
3-(6-chloro-3-pyridinyl)-8-(dimethylamino)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 142729367) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-8-(dimethylamino)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | 3-(6-chloro-3-pyridinyl)-8-(dimethylamino)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 142729367 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-8-(dimethylamino)-6-phenyl-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | CN(C)C1C=C(c2ccccc2)C(=O)N2C(c3ccc(Cl)nc3)CCC12 |
| InChI | InChI=1S/C21H22ClN3O/c1-24(2)19-12-16(14-6-4-3-5-7-14)21(26)25-17(9-10-18(19)25)15-8-11-20(22)23-13-15/h3-8,11-13,17-19H,9-10H2,1-2H3 |
| InChIKey | YNJOIYWOMXASJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|