About 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide
5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide (PubChem CID 142729580) has the molecular formula C11H7FIN3O3
and a molecular weight of 375.10 g/mol. Its IUPAC name is 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide.
Molecular Properties
| Compound Name | 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide |
| PubChem CID | 142729580 |
| Molecular Formula | C11H7FIN3O3 |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide |
| SMILES | O=C(NC1=NC=IC=C1)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7FIN3O3/c12-7-1-2-9(16(18)19)8(5-7)11(17)15-10-3-4-13-6-14-10/h1-6H,(H,14,15,17) |
| InChIKey | OSSMKDXWOUGEOB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide?
The IUPAC name of 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide (CID 142729580) is 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide.
What is the SMILES notation for 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide?
The canonical SMILES for 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide is O=C(NC1=NC=IC=C1)c1cc(F)ccc1[N+](=O)[O-].
What is the InChIKey of 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide?
The InChIKey is OSSMKDXWOUGEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FIN3O3/c12-7-1-2-9(16(18)19)8(5-7)11(17)15-10-3-4-13-6-14-10/h1-6H,(H,14,15,17).
What are the key properties of 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide?
5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide has a molecular weight of 375.10 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-(1λ3-ioda-3-azacyclohexa-1,3,5-trien-4-yl)-2-nitrobenzamide is sourced from PubChem (CID 142729580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).