C17H20ClNO2 — CID 142729709
2-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]acetamide;hydrochloride (PubChem CID 142729709) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 142729709 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(4-methylphenyl)methyl]acetamide;hydrochloride |
| SMILES | COc1ccc(CC(=O)NCc2ccc(C)cc2)cc1.Cl |
| InChI | InChI=1S/C17H19NO2.ClH/c1-13-3-5-15(6-4-13)12-18-17(19)11-14-7-9-16(20-2)10-8-14;/h3-10H,11-12H2,1-2H3,(H,18,19);1H |
| InChIKey | HHJFHNZCIYHYNN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |