propyl 2,3-diethyl-4-oxopentanoate

C12H22O3 — CID 142730005

IUPACpropyl 2,3-diethyl-4-oxopentanoate
SMILESCCCOC(=O)C(CC)C(CC)C(C)=O
InChIInChI=1S/C12H22O3/c1-5-8-15-12(14)11(7-3)10(6-2)9(4)13/h10-11H,5-8H2,1-4H3
InChIKeyJJHGTHRMUCDILA-UHFFFAOYSA-N
MW214.30 g/mol
LogP2.58
Rot. Bonds7

About propyl 2,3-diethyl-4-oxopentanoate

propyl 2,3-diethyl-4-oxopentanoate (PubChem CID 142730005) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is propyl 2,3-diethyl-4-oxopentanoate.

Molecular Properties

Compound Namepropyl 2,3-diethyl-4-oxopentanoate
PubChem CID142730005
Molecular FormulaC12H22O3
Molecular Weight214.30 g/mol
Exact Mass214.16
IUPAC Namepropyl 2,3-diethyl-4-oxopentanoate
SMILESCCCOC(=O)C(CC)C(CC)C(C)=O
InChIInChI=1S/C12H22O3/c1-5-8-15-12(14)11(7-3)10(6-2)9(4)13/h10-11H,5-8H2,1-4H3
InChIKeyJJHGTHRMUCDILA-UHFFFAOYSA-N
XLogP2.58
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.30
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze propyl 2,3-diethyl-4-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propyl 2,3-diethyl-4-oxopentanoate?
The IUPAC name of propyl 2,3-diethyl-4-oxopentanoate (CID 142730005) is propyl 2,3-diethyl-4-oxopentanoate.
What is the SMILES notation for propyl 2,3-diethyl-4-oxopentanoate?
The canonical SMILES for propyl 2,3-diethyl-4-oxopentanoate is CCCOC(=O)C(CC)C(CC)C(C)=O.
What is the InChIKey of propyl 2,3-diethyl-4-oxopentanoate?
The InChIKey is JJHGTHRMUCDILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-8-15-12(14)11(7-3)10(6-2)9(4)13/h10-11H,5-8H2,1-4H3.
What are the key properties of propyl 2,3-diethyl-4-oxopentanoate?
propyl 2,3-diethyl-4-oxopentanoate has a molecular weight of 214.30 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2,3-diethyl-4-oxopentanoate is sourced from PubChem (CID 142730005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).