C21H26F3NO5S — CID 142730062
bis(prop-2-enyl) 2-[(1R)-1-[[(R)-tert-butylsulfinyl]amino]-2-(2,4,5-trifluorophenyl)ethyl]propanedioate (PubChem CID 142730062) has the molecular formula C21H26F3NO5S and a molecular weight of 461.50 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[(1R)-1-[[(R)-tert-butylsulfinyl]amino]-2-(2,4,5-trifluorophenyl)ethyl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[(1R)-1-[[(R)-tert-butylsulfinyl]amino]-2-(2,4,5-trifluorophenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 142730062 |
| Molecular Formula | C21H26F3NO5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | bis(prop-2-enyl) 2-[(1R)-1-[[(R)-tert-butylsulfinyl]amino]-2-(2,4,5-trifluorophenyl)ethyl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)[C@@H](Cc1cc(F)c(F)cc1F)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C21H26F3NO5S/c1-6-8-29-19(26)18(20(27)30-9-7-2)17(25-31(28)21(3,4)5)11-13-10-15(23)16(24)12-14(13)22/h6-7,10,12,17-18,25H,1-2,8-9,11H2,3-5H3/t17-,31-/m1/s1 |
| InChIKey | LJLBRXSBXYWQKN-AUMHUTNHSA-N |
| XLogP | 3.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|