C16H22F3NO3S — CID 142730065
ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 142730065) has the molecular formula C16H22F3NO3S and a molecular weight of 365.42 g/mol. Its IUPAC name is ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 142730065 |
| Molecular Formula | C16H22F3NO3S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | ethyl (3R)-3-[[(R)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | CCOC(=O)C[C@@H](Cc1cc(F)c(F)cc1F)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C16H22F3NO3S/c1-5-23-15(21)8-11(20-24(22)16(2,3)4)6-10-7-13(18)14(19)9-12(10)17/h7,9,11,20H,5-6,8H2,1-4H3/t11-,24-/m1/s1 |
| InChIKey | QURYHNHMPVQDJR-YDGUKXNOSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|