About (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate
(2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate (PubChem CID 142730227) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate.
Molecular Properties
| Compound Name | (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate |
| PubChem CID | 142730227 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate |
| SMILES | CC(=O)OC1(C)CC2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C11H14O4/c1-7(12)14-11(2)6-8-9(13)4-3-5-10(8)15-11/h3-6H2,1-2H3 |
| InChIKey | FVBLUCZIKDCTDR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate?
The IUPAC name of (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate (CID 142730227) is (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate.
What is the SMILES notation for (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate?
The canonical SMILES for (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate is CC(=O)OC1(C)CC2=C(CCCC2=O)O1.
What is the InChIKey of (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate?
The InChIKey is FVBLUCZIKDCTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-7(12)14-11(2)6-8-9(13)4-3-5-10(8)15-11/h3-6H2,1-2H3.
What are the key properties of (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate?
(2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate has a molecular weight of 210.23 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-oxo-3,5,6,7-tetrahydro-1-benzofuran-2-yl) acetate is sourced from PubChem (CID 142730227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).