C11H10N2O5 — CID 142730457
5-[(2,4-dihydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 142730457) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-[(2,4-dihydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4-dihydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142730457 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-[(2,4-dihydroxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(Cc2ccc(O)cc2O)C(=O)N1 |
| InChI | InChI=1S/C11H10N2O5/c14-6-2-1-5(8(15)4-6)3-7-9(16)12-11(18)13-10(7)17/h1-2,4,7,14-15H,3H2,(H2,12,13,16,17,18) |
| InChIKey | XHFTUYJOPZLAAK-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|