C23H20N4O3S — CID 142730541
N-[(4-methoxyphenyl)methyl]-8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-amine (PubChem CID 142730541) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-amine |
|---|---|
| PubChem CID | 142730541 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-amine |
| SMILES | COc1ccc(CNc2nc3nc4c(c(-c5ccc([N+](=O)[O-])cc5)c3s2)CCC4)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-30-17-11-5-14(6-12-17)13-24-23-26-22-21(31-23)20(18-3-2-4-19(18)25-22)15-7-9-16(10-8-15)27(28)29/h5-12H,2-4,13H2,1H3,(H,24,25,26) |
| InChIKey | LEMMYXGRJOZRDA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|