C9H13NO3 — CID 142730843
5-(hydroxymethyl)-1-(3-hydroxypropyl)pyrrole-2-carbaldehyde (PubChem CID 142730843) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1-(3-hydroxypropyl)pyrrole-2-carbaldehyde.
| Compound Name | 5-(hydroxymethyl)-1-(3-hydroxypropyl)pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 142730843 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-(hydroxymethyl)-1-(3-hydroxypropyl)pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(CO)n1CCCO |
| InChI | InChI=1S/C9H13NO3/c11-5-1-4-10-8(6-12)2-3-9(10)7-13/h2-3,6,11,13H,1,4-5,7H2 |
| InChIKey | CAVQPTTWOKILMX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|