C41H27N5 — CID 142731088
11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolizino[3,2-b]indole (PubChem CID 142731088) has the molecular formula C41H27N5 and a molecular weight of 589.70 g/mol. Its IUPAC name is 11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolizino[3,2-b]indole.
| Compound Name | 11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolizino[3,2-b]indole |
|---|---|
| PubChem CID | 142731088 |
| Molecular Formula | C41H27N5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 11-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5-phenylindolizino[3,2-b]indole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4c5c6ccccc6n(-c6ccccc6)c5n5ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C41H27N5/c1-4-15-28(16-5-1)38-42-39(29-17-6-2-7-18-29)44-40(43-38)31-20-14-19-30(27-31)36-35-25-12-13-26-45(35)41-37(36)33-23-10-11-24-34(33)46(41)32-21-8-3-9-22-32/h1-27H |
| InChIKey | LRYAUMDBKZJCSY-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |