C27H34O4 — CID 142731416
3,6-ditert-butyl-1,2-diethylfluorene-9,9-dicarboxylic acid (PubChem CID 142731416) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,2-diethylfluorene-9,9-dicarboxylic acid.
| Compound Name | 3,6-ditert-butyl-1,2-diethylfluorene-9,9-dicarboxylic acid |
|---|---|
| PubChem CID | 142731416 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 3,6-ditert-butyl-1,2-diethylfluorene-9,9-dicarboxylic acid |
| SMILES | CCc1c(C(C)(C)C)cc2c(c1CC)C(C(=O)O)(C(=O)O)c1ccc(C(C)(C)C)cc1-2 |
| InChI | InChI=1S/C27H34O4/c1-9-16-17(10-2)22-19(14-21(16)26(6,7)8)18-13-15(25(3,4)5)11-12-20(18)27(22,23(28)29)24(30)31/h11-14H,9-10H2,1-8H3,(H,28,29)(H,30,31) |
| InChIKey | APXKFROJLPAJAH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|