About 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid
1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid (PubChem CID 142731855) has the molecular formula C22H21NO3S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid |
| PubChem CID | 142731855 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid |
| SMILES | CSc1ccc2c(c1)CC(CCn1c(=O)c(C(=O)O)cc3ccccc31)C2 |
| InChI | InChI=1S/C22H21NO3S/c1-27-18-7-6-15-10-14(11-17(15)12-18)8-9-23-20-5-3-2-4-16(20)13-19(21(23)24)22(25)26/h2-7,12-14H,8-11H2,1H3,(H,25,26) |
| InChIKey | MPYQKORDZJZILW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid?
The IUPAC name of 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid (CID 142731855) is 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid is CSc1ccc2c(c1)CC(CCn1c(=O)c(C(=O)O)cc3ccccc31)C2.
What is the InChIKey of 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid?
The InChIKey is MPYQKORDZJZILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3S/c1-27-18-7-6-15-10-14(11-17(15)12-18)8-9-23-20-5-3-2-4-16(20)13-19(21(23)24)22(25)26/h2-7,12-14H,8-11H2,1H3,(H,25,26).
What are the key properties of 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid?
1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid has a molecular weight of 379.48 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-methylsulfanyl-2,3-dihydro-1H-inden-2-yl)ethyl]-2-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 142731855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).