C16H28O2 — CID 142732259
4,5-dibutyloct-4-ene-3,6-dione (PubChem CID 142732259) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,5-dibutyloct-4-ene-3,6-dione.
| Compound Name | 4,5-dibutyloct-4-ene-3,6-dione |
|---|---|
| PubChem CID | 142732259 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 4,5-dibutyloct-4-ene-3,6-dione |
| SMILES | CCCCC(C(=O)CC)=C(CCCC)C(=O)CC |
| InChI | InChI=1S/C16H28O2/c1-5-9-11-13(15(17)7-3)14(12-10-6-2)16(18)8-4/h5-12H2,1-4H3 |
| InChIKey | LMLBPXSLLDQSRF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|