About 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one
7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one (PubChem CID 142732398) has the molecular formula C12H14BrO4P
and a molecular weight of 333.12 g/mol. Its IUPAC name is 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one.
Molecular Properties
| Compound Name | 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one |
| PubChem CID | 142732398 |
| Molecular Formula | C12H14BrO4P |
| Molecular Weight | 333.12 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one |
| SMILES | CCOP1(=O)OC(=O)c2cc(Br)ccc2C1(C)C |
| InChI | InChI=1S/C12H14BrO4P/c1-4-16-18(15)12(2,3)10-6-5-8(13)7-9(10)11(14)17-18/h5-7H,4H2,1-3H3 |
| InChIKey | LEUFKSJZMVHGIC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one?
The IUPAC name of 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one (CID 142732398) is 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one.
What is the SMILES notation for 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one?
The canonical SMILES for 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one is CCOP1(=O)OC(=O)c2cc(Br)ccc2C1(C)C.
What is the InChIKey of 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one?
The InChIKey is LEUFKSJZMVHGIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrO4P/c1-4-16-18(15)12(2,3)10-6-5-8(13)7-9(10)11(14)17-18/h5-7H,4H2,1-3H3.
What are the key properties of 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one?
7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one has a molecular weight of 333.12 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-ethoxy-4,4-dimethyl-3-oxo-2,3λ5-benzoxaphosphinin-1-one is sourced from PubChem (CID 142732398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).