About 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one
2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 142733070) has the molecular formula C8H10N4OS
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one |
| PubChem CID | 142733070 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | [2H]C1([2H])NC(=O)c2cnc(SC)nc2N1C |
| InChI | InChI=1S/C8H10N4OS/c1-12-4-10-7(13)5-3-9-8(14-2)11-6(5)12/h3H,4H2,1-2H3,(H,10,13)/i4D2 |
| InChIKey | OEOJCYYSXUZKPN-APZFVMQVSA-N |
| XLogP | 0.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one?
The IUPAC name of 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one (CID 142733070) is 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one.
What is the SMILES notation for 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one?
The canonical SMILES for 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one is [2H]C1([2H])NC(=O)c2cnc(SC)nc2N1C.
What is the InChIKey of 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one?
The InChIKey is OEOJCYYSXUZKPN-APZFVMQVSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-12-4-10-7(13)5-3-9-8(14-2)11-6(5)12/h3H,4H2,1-2H3,(H,10,13)/i4D2.
What are the key properties of 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one?
2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one has a molecular weight of 212.27 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dideuterio-1-methyl-7-methylsulfanyl-3H-pyrimido[4,5-d]pyrimidin-4-one is sourced from PubChem (CID 142733070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).