C25H24F8N4O3S — CID 142733730
2-[3-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 142733730) has the molecular formula C25H24F8N4O3S and a molecular weight of 612.54 g/mol. Its IUPAC name is 2-[3-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 142733730 |
| Molecular Formula | C25H24F8N4O3S |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | 2-[3-[4-(4-cyclopropylsulfonylpiperazin-1-yl)phenyl]-2-(2,4-difluorophenyl)-3,4-dihydropyrazol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=S(=O)(C1CC1)N1CCN(c2ccc(C3CC(C(O)(C(F)(F)F)C(F)(F)F)=NN3c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C25H24F8N4O3S/c26-16-3-8-20(19(27)13-16)37-21(14-22(34-37)23(38,24(28,29)30)25(31,32)33)15-1-4-17(5-2-15)35-9-11-36(12-10-35)41(39,40)18-6-7-18/h1-5,8,13,18,21,38H,6-7,9-12,14H2 |
| InChIKey | NBRPDROETGQTEC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|