4-amino-2-fluoro-3,3-dimethylbutanoic acid

C6H12FNO2 — CID 142734398

IUPAC4-amino-2-fluoro-3,3-dimethylbutanoic acid
SMILESCC(C)(CN)C(F)C(=O)O
InChIInChI=1S/C6H12FNO2/c1-6(2,3-8)4(7)5(9)10/h4H,3,8H2,1-2H3,(H,9,10)
InChIKeyHHVPOGWXLGKRDQ-UHFFFAOYSA-N
MW149.16 g/mol
LogP0.39
Rot. Bonds3

About 4-amino-2-fluoro-3,3-dimethylbutanoic acid

4-amino-2-fluoro-3,3-dimethylbutanoic acid (PubChem CID 142734398) has the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. Its IUPAC name is 4-amino-2-fluoro-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name4-amino-2-fluoro-3,3-dimethylbutanoic acid
PubChem CID142734398
Molecular FormulaC6H12FNO2
Molecular Weight149.16 g/mol
Exact Mass149.09
IUPAC Name4-amino-2-fluoro-3,3-dimethylbutanoic acid
SMILESCC(C)(CN)C(F)C(=O)O
InChIInChI=1S/C6H12FNO2/c1-6(2,3-8)4(7)5(9)10/h4H,3,8H2,1-2H3,(H,9,10)
InChIKeyHHVPOGWXLGKRDQ-UHFFFAOYSA-N
XLogP0.39
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.16
LogP ≤ 50.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-amino-2-fluoro-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2-fluoro-3,3-dimethylbutanoic acid?
The IUPAC name of 4-amino-2-fluoro-3,3-dimethylbutanoic acid (CID 142734398) is 4-amino-2-fluoro-3,3-dimethylbutanoic acid.
What is the SMILES notation for 4-amino-2-fluoro-3,3-dimethylbutanoic acid?
The canonical SMILES for 4-amino-2-fluoro-3,3-dimethylbutanoic acid is CC(C)(CN)C(F)C(=O)O.
What is the InChIKey of 4-amino-2-fluoro-3,3-dimethylbutanoic acid?
The InChIKey is HHVPOGWXLGKRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO2/c1-6(2,3-8)4(7)5(9)10/h4H,3,8H2,1-2H3,(H,9,10).
What are the key properties of 4-amino-2-fluoro-3,3-dimethylbutanoic acid?
4-amino-2-fluoro-3,3-dimethylbutanoic acid has a molecular weight of 149.16 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-fluoro-3,3-dimethylbutanoic acid is sourced from PubChem (CID 142734398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).