C14H14FNO2 — CID 142734613
7-ethenyl-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 142734613) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 7-ethenyl-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 7-ethenyl-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 142734613 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 7-ethenyl-6-fluoro-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CC1C(F)C(=O)N2C(c3ccccc3)OCC12 |
| InChI | InChI=1S/C14H14FNO2/c1-2-10-11-8-18-14(9-6-4-3-5-7-9)16(11)13(17)12(10)15/h2-7,10-12,14H,1,8H2 |
| InChIKey | SJHQDWIZEMYHCZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|