About butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride
butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride (PubChem CID 142734960) has the molecular formula C10H21ClN4O
and a molecular weight of 248.76 g/mol. Its IUPAC name is butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride.
Molecular Properties
| Compound Name | butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride |
| PubChem CID | 142734960 |
| Molecular Formula | C10H21ClN4O |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(\N)N1CCCC1)OCCCC |
| InChI | InChI=1S/C10H20N4O.ClH/c1-2-3-8-15-10(12)13-9(11)14-6-4-5-7-14;/h2-8H2,1H3,(H3,11,12,13);1H |
| InChIKey | RZUOYYNMCVWNRK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride?
The IUPAC name of butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride (CID 142734960) is butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride.
What is the SMILES notation for butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride?
The canonical SMILES for butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride is Cl.[H]/N=C(/N=C(\N)N1CCCC1)OCCCC.
What is the InChIKey of butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride?
The InChIKey is RZUOYYNMCVWNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O.ClH/c1-2-3-8-15-10(12)13-9(11)14-6-4-5-7-14;/h2-8H2,1H3,(H3,11,12,13);1H.
What are the key properties of butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride?
butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride has a molecular weight of 248.76 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (NE)-N-[amino(pyrrolidin-1-yl)methylidene]carbamimidate;hydrochloride is sourced from PubChem (CID 142734960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).