C24H27BF4N4O2 — CID 142735491
1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane tetrafluoroborate (PubChem CID 142735491) has the molecular formula C24H27BF4N4O2 and a molecular weight of 490.31 g/mol. Its IUPAC name is 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane tetrafluoroborate.
| Compound Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane tetrafluoroborate |
|---|---|
| PubChem CID | 142735491 |
| Molecular Formula | C24H27BF4N4O2 |
| Molecular Weight | 490.31 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(COc2nc(OCc3ccccc3)nc([N+]34CCC(CC3)CC4)n2)cc1 |
| InChI | InChI=1S/C24H27N4O2.BF4/c1-3-7-20(8-4-1)17-29-23-25-22(28-14-11-19(12-15-28)13-16-28)26-24(27-23)30-18-21-9-5-2-6-10-21;2-1(3,4)5/h1-10,19H,11-18H2;/q+1;-1 |
| InChIKey | COPVTYSUICXAHS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|