C24H27N4O2+ — CID 142735492
1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane (PubChem CID 142735492) has the molecular formula C24H27N4O2+ and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 142735492 |
| Molecular Formula | C24H27N4O2+ |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[4,6-bis(phenylmethoxy)-1,3,5-triazin-2-yl]-1-azoniabicyclo[2.2.2]octane |
| SMILES | c1ccc(COc2nc(OCc3ccccc3)nc([N+]34CCC(CC3)CC4)n2)cc1 |
| InChI | InChI=1S/C24H27N4O2/c1-3-7-20(8-4-1)17-29-23-25-22(28-14-11-19(12-15-28)13-16-28)26-24(27-23)30-18-21-9-5-2-6-10-21/h1-10,19H,11-18H2/q+1 |
| InChIKey | LUNNABCQYHDRDJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|