C16H14F3N5 — CID 142737235
(2R)-1-(4-pyridin-3-yltriazol-1-yl)-3-(2,4,5-trifluorophenyl)propan-2-amine (PubChem CID 142737235) has the molecular formula C16H14F3N5 and a molecular weight of 333.32 g/mol. Its IUPAC name is (2R)-1-(4-pyridin-3-yltriazol-1-yl)-3-(2,4,5-trifluorophenyl)propan-2-amine.
| Compound Name | (2R)-1-(4-pyridin-3-yltriazol-1-yl)-3-(2,4,5-trifluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 142737235 |
| Molecular Formula | C16H14F3N5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R)-1-(4-pyridin-3-yltriazol-1-yl)-3-(2,4,5-trifluorophenyl)propan-2-amine |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)Cn1cc(-c2cccnc2)nn1 |
| InChI | InChI=1S/C16H14F3N5/c17-13-6-15(19)14(18)5-11(13)4-12(20)8-24-9-16(22-23-24)10-2-1-3-21-7-10/h1-3,5-7,9,12H,4,8,20H2/t12-/m1/s1 |
| InChIKey | VDQIGCRJQHOAKK-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|