C17H16F3N5 — CID 142737236
4-(4-pyridin-3-yltriazol-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-amine (PubChem CID 142737236) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-(4-pyridin-3-yltriazol-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-amine.
| Compound Name | 4-(4-pyridin-3-yltriazol-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 142737236 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-(4-pyridin-3-yltriazol-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-amine |
| SMILES | NC(CCn1cc(-c2cccnc2)nn1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H16F3N5/c18-14-8-16(20)15(19)7-12(14)6-13(21)3-5-25-10-17(23-24-25)11-2-1-4-22-9-11/h1-2,4,7-10,13H,3,5-6,21H2 |
| InChIKey | GGFKMAWOFGZHFK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|