C14H18O8 — CID 142737344
(4E)-3,6,16-trioxo-1,2,7-trioxacyclohexadec-4-ene-8-carboxylic acid (PubChem CID 142737344) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is (4E)-3,6,16-trioxo-1,2,7-trioxacyclohexadec-4-ene-8-carboxylic acid.
| Compound Name | (4E)-3,6,16-trioxo-1,2,7-trioxacyclohexadec-4-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 142737344 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4E)-3,6,16-trioxo-1,2,7-trioxacyclohexadec-4-ene-8-carboxylic acid |
| SMILES | O=C1/C=C/C(=O)OC(C(=O)O)CCCCCCCC(=O)OO1 |
| InChI | InChI=1S/C14H18O8/c15-11-8-9-13(17)22-21-12(16)7-5-3-1-2-4-6-10(20-11)14(18)19/h8-10H,1-7H2,(H,18,19)/b9-8+ |
| InChIKey | ZAWLGVOTLRSATK-CMDGGOBGSA-N |
| XLogP | 1.28 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|