C14H18O3 — CID 142737377
(2R)-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-2,6-diol (PubChem CID 142737377) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2R)-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-2,6-diol.
| Compound Name | (2R)-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-2,6-diol |
|---|---|
| PubChem CID | 142737377 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2R)-7-(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-2,6-diol |
| SMILES | CC(C)=CCc1cc2c(cc1O)CC[C@H](O)O2 |
| InChI | InChI=1S/C14H18O3/c1-9(2)3-4-10-8-13-11(7-12(10)15)5-6-14(16)17-13/h3,7-8,14-16H,4-6H2,1-2H3/t14-/m1/s1 |
| InChIKey | OWBMTFLOUGRQHD-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|