C18H35NO3Si — CID 142737703
8-ethenyl-2-ethyl-2-methoxy-6-(3-methoxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737703) has the molecular formula C18H35NO3Si and a molecular weight of 341.57 g/mol. Its IUPAC name is 8-ethenyl-2-ethyl-2-methoxy-6-(3-methoxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 8-ethenyl-2-ethyl-2-methoxy-6-(3-methoxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737703 |
| Molecular Formula | C18H35NO3Si |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 8-ethenyl-2-ethyl-2-methoxy-6-(3-methoxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | C=CC1CCC2O[Si](CC)(OC)CCCN(CCCOC)C2C1 |
| InChI | InChI=1S/C18H35NO3Si/c1-5-16-9-10-18-17(15-16)19(11-7-13-20-3)12-8-14-23(6-2,21-4)22-18/h5,16-18H,1,6-15H2,2-4H3 |
| InChIKey | ZWIPJVPBZVFKDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|