C16H31NO4Si — CID 142737722
8-ethenyl-2,2-dimethoxy-6-(2-methoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737722) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is 8-ethenyl-2,2-dimethoxy-6-(2-methoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 8-ethenyl-2,2-dimethoxy-6-(2-methoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737722 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 8-ethenyl-2,2-dimethoxy-6-(2-methoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | C=CC1CCC2O[Si](OC)(OC)CCCN(CCOC)C2C1 |
| InChI | InChI=1S/C16H31NO4Si/c1-5-14-7-8-16-15(13-14)17(10-11-18-2)9-6-12-22(19-3,20-4)21-16/h5,14-16H,1,6-13H2,2-4H3 |
| InChIKey | VVCSGOTVNTZUGR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|