C23H45NO4Si — CID 142737739
2,2-dibutoxy-8-ethenyl-6-(2-ethoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737739) has the molecular formula C23H45NO4Si and a molecular weight of 427.70 g/mol. Its IUPAC name is 2,2-dibutoxy-8-ethenyl-6-(2-ethoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 2,2-dibutoxy-8-ethenyl-6-(2-ethoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737739 |
| Molecular Formula | C23H45NO4Si |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 2,2-dibutoxy-8-ethenyl-6-(2-ethoxyethyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | C=CC1CCC2O[Si](OCCCC)(OCCCC)CCCN(CCOCC)C2C1 |
| InChI | InChI=1S/C23H45NO4Si/c1-5-9-16-26-29(27-17-10-6-2)19-11-14-24(15-18-25-8-4)22-20-21(7-3)12-13-23(22)28-29/h7,21-23H,3,5-6,8-20H2,1-2,4H3 |
| InChIKey | OGDJNSSCSIKVOM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|