C21H41NO4Si — CID 142737766
8-ethenyl-6-(3-methoxypropyl)-2,2-dipropoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737766) has the molecular formula C21H41NO4Si and a molecular weight of 399.65 g/mol. Its IUPAC name is 8-ethenyl-6-(3-methoxypropyl)-2,2-dipropoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 8-ethenyl-6-(3-methoxypropyl)-2,2-dipropoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737766 |
| Molecular Formula | C21H41NO4Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 8-ethenyl-6-(3-methoxypropyl)-2,2-dipropoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | C=CC1CCC2O[Si](OCCC)(OCCC)CCCN(CCCOC)C2C1 |
| InChI | InChI=1S/C21H41NO4Si/c1-5-14-24-27(25-15-6-2)17-9-13-22(12-8-16-23-4)20-18-19(7-3)10-11-21(20)26-27/h7,19-21H,3,5-6,8-18H2,1-2,4H3 |
| InChIKey | DCLAUNPDZTYXAM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|