C7H18ClNSi2 — CID 142738285
1-(chloromethyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 142738285) has the molecular formula C7H18ClNSi2 and a molecular weight of 207.85 g/mol. Its IUPAC name is 1-(chloromethyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-(chloromethyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 142738285 |
| Molecular Formula | C7H18ClNSi2 |
| Molecular Weight | 207.85 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-(chloromethyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1CCl |
| InChI | InChI=1S/C7H18ClNSi2/c1-10(2)5-6-11(3,4)9(10)7-8/h5-7H2,1-4H3 |
| InChIKey | ALPHHLOPTUUGIT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|