C21H13ClFN3O3S — CID 142738851
3-[[3-(5-chlorothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]-4-fluorobenzoic acid (PubChem CID 142738851) has the molecular formula C21H13ClFN3O3S and a molecular weight of 441.87 g/mol. Its IUPAC name is 3-[[3-(5-chlorothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]-4-fluorobenzoic acid.
| Compound Name | 3-[[3-(5-chlorothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 142738851 |
| Molecular Formula | C21H13ClFN3O3S |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 3-[[3-(5-chlorothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NC(=O)c2cn(-c3ccccc3)nc2-c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C21H13ClFN3O3S/c22-18-9-8-17(30-18)19-14(11-26(25-19)13-4-2-1-3-5-13)20(27)24-16-10-12(21(28)29)6-7-15(16)23/h1-11H,(H,24,27)(H,28,29) |
| InChIKey | UDACCXNTNXAYPJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |