C20H14BrN3O4S2 — CID 142738881
3-[[3-(5-bromothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzenesulfonic acid (PubChem CID 142738881) has the molecular formula C20H14BrN3O4S2 and a molecular weight of 504.39 g/mol. Its IUPAC name is 3-[[3-(5-bromothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[3-(5-bromothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 142738881 |
| Molecular Formula | C20H14BrN3O4S2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 502.96 |
| IUPAC Name | 3-[[3-(5-bromothiophen-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzenesulfonic acid |
| SMILES | O=C(Nc1cccc(S(=O)(=O)O)c1)c1cn(-c2ccccc2)nc1-c1ccc(Br)s1 |
| InChI | InChI=1S/C20H14BrN3O4S2/c21-18-10-9-17(29-18)19-16(12-24(23-19)14-6-2-1-3-7-14)20(25)22-13-5-4-8-15(11-13)30(26,27)28/h1-12H,(H,22,25)(H,26,27,28) |
| InChIKey | XAUAFDQJWCMGAN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|