C18H22N2O3S — CID 142739191
butyl N-[(2-pyridin-3-yl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methyl]carbamate (PubChem CID 142739191) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is butyl N-[(2-pyridin-3-yl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methyl]carbamate.
| Compound Name | butyl N-[(2-pyridin-3-yl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 142739191 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | butyl N-[(2-pyridin-3-yl-6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)methyl]carbamate |
| SMILES | CCCCOC(=O)NCC1OCCc2sc(-c3cccnc3)cc21 |
| InChI | InChI=1S/C18H22N2O3S/c1-2-3-8-23-18(21)20-12-15-14-10-17(13-5-4-7-19-11-13)24-16(14)6-9-22-15/h4-5,7,10-11,15H,2-3,6,8-9,12H2,1H3,(H,20,21) |
| InChIKey | ZEFSUBULJVUVJZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|