About O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate
O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate (PubChem CID 142739259) has the molecular formula C20H15FN2OS2
and a molecular weight of 382.49 g/mol. Its IUPAC name is O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
| PubChem CID | 142739259 |
| Molecular Formula | C20H15FN2OS2 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1ccc2cnsc2c1-c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C20H15FN2OS2/c1-23(2)20(25)24-17-10-7-12-11-22-26-19(12)18(17)15-8-9-16(21)14-6-4-3-5-13(14)15/h3-11H,1-2H3 |
| InChIKey | YSNXULDKKMWVPW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate?
The IUPAC name of O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate (CID 142739259) is O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate.
What is the SMILES notation for O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate?
The canonical SMILES for O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate is CN(C)C(=S)Oc1ccc2cnsc2c1-c1ccc(F)c2ccccc12.
What is the InChIKey of O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate?
The InChIKey is YSNXULDKKMWVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2OS2/c1-23(2)20(25)24-17-10-7-12-11-22-26-19(12)18(17)15-8-9-16(21)14-6-4-3-5-13(14)15/h3-11H,1-2H3.
What are the key properties of O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate?
O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate has a molecular weight of 382.49 g/mol, XLogP of 5.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[[7-(4-fluoronaphthalen-1-yl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate is sourced from PubChem (CID 142739259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).