C20H29F9 — CID 14273943
1-butyl-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexyl]cyclohexane (PubChem CID 14273943) has the molecular formula C20H29F9 and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-butyl-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexyl]cyclohexane.
| Compound Name | 1-butyl-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 14273943 |
| Molecular Formula | C20H29F9 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-butyl-4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexyl]cyclohexane |
| SMILES | CCCCC1CCC(C2CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C20H29F9/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(12-10-15)17(21,22)18(23,24)19(25,26)20(27,28)29/h13-16H,2-12H2,1H3 |
| InChIKey | RJMMPZDRCIRQMG-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|