About 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol
6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol (PubChem CID 142739914) has the molecular formula C18H13NO3
and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol |
| PubChem CID | 142739914 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol |
| SMILES | OCc1ccc2oc(-c3ccc4cc(O)ccc4c3)nc2c1 |
| InChI | InChI=1S/C18H13NO3/c20-10-11-1-6-17-16(7-11)19-18(22-17)14-3-2-13-9-15(21)5-4-12(13)8-14/h1-9,20-21H,10H2 |
| InChIKey | RSJXUDABXOINMX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol?
The IUPAC name of 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol (CID 142739914) is 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol.
What is the SMILES notation for 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol?
The canonical SMILES for 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol is OCc1ccc2oc(-c3ccc4cc(O)ccc4c3)nc2c1.
What is the InChIKey of 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol?
The InChIKey is RSJXUDABXOINMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO3/c20-10-11-1-6-17-16(7-11)19-18(22-17)14-3-2-13-9-15(21)5-4-12(13)8-14/h1-9,20-21H,10H2.
What are the key properties of 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol?
6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol has a molecular weight of 291.31 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]naphthalen-2-ol is sourced from PubChem (CID 142739914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).