C23H24F4N6O2S — CID 142740571
(1S,3R)-3-[2-fluoro-5-[3-(5-methoxypyrazin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine (PubChem CID 142740571) has the molecular formula C23H24F4N6O2S and a molecular weight of 524.54 g/mol. Its IUPAC name is (1S,3R)-3-[2-fluoro-5-[3-(5-methoxypyrazin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine.
| Compound Name | (1S,3R)-3-[2-fluoro-5-[3-(5-methoxypyrazin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 142740571 |
| Molecular Formula | C23H24F4N6O2S |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | (1S,3R)-3-[2-fluoro-5-[3-(5-methoxypyrazin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-(2,2,2-trifluoroethylimino)-2H-1,4-thiazin-5-amine |
| SMILES | COc1cnc(-c2cc(-c3ccc(F)c([C@]4(C)C/[S@](=N\CC(F)(F)F)C(C)(C)C(N)=N4)c3)on2)cn1 |
| InChI | InChI=1S/C23H24F4N6O2S/c1-21(2)20(28)32-22(3,12-36(21)31-11-23(25,26)27)14-7-13(5-6-15(14)24)18-8-16(33-35-18)17-9-30-19(34-4)10-29-17/h5-10H,11-12H2,1-4H3,(H2,28,32)/t22-,36-/m0/s1 |
| InChIKey | UTQJYERVKKPAKS-YMLFONJDSA-N |
| XLogP | 4.68 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |