C13H18N2O3S — CID 142740743
2-(2-morpholin-4-ylethyl)-3H-1,2-benzothiazole 1,1-dioxide (PubChem CID 142740743) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethyl)-3H-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2-(2-morpholin-4-ylethyl)-3H-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 142740743 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(2-morpholin-4-ylethyl)-3H-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)c2ccccc2CN1CCN1CCOCC1 |
| InChI | InChI=1S/C13H18N2O3S/c16-19(17)13-4-2-1-3-12(13)11-15(19)6-5-14-7-9-18-10-8-14/h1-4H,5-11H2 |
| InChIKey | DSBVKILDPYFBFI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |