C25H43F13O6Si2 — CID 142741253
dimethoxy-[10-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)decyl]-(2-trimethoxysilylethyl)silane (PubChem CID 142741253) has the molecular formula C25H43F13O6Si2 and a molecular weight of 742.76 g/mol. Its IUPAC name is dimethoxy-[10-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)decyl]-(2-trimethoxysilylethyl)silane.
| Compound Name | dimethoxy-[10-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)decyl]-(2-trimethoxysilylethyl)silane |
|---|---|
| PubChem CID | 142741253 |
| Molecular Formula | C25H43F13O6Si2 |
| Molecular Weight | 742.76 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | dimethoxy-[10-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)decyl]-(2-trimethoxysilylethyl)silane |
| SMILES | CO[Si](CCCCCCCCCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CC[Si](OC)(OC)OC)OC |
| InChI | InChI=1S/C25H43F13O6Si2/c1-39-45(40-2,18-19-46(41-3,42-4)43-5)17-13-11-9-7-6-8-10-12-15-44-16-14-20(26,27)21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)38/h6-19H2,1-5H3 |
| InChIKey | JIJWXJNBNRCSBH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.76 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|