About 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one
9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one (PubChem CID 142741657) has the molecular formula C23H12ClNO4
and a molecular weight of 401.81 g/mol. Its IUPAC name is 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one |
| PubChem CID | 142741657 |
| Molecular Formula | C23H12ClNO4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one |
| SMILES | O=C(c1cnc2c(c1)c(=O)oc1ccc(Cl)cc12)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C23H12ClNO4/c24-14-6-8-19-17(10-14)20-18(23(28)29-19)9-13(11-25-20)21(26)16-7-5-12-3-1-2-4-15(12)22(16)27/h1-11,27H |
| InChIKey | PADGHJDRSIZXAE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one?
The IUPAC name of 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one (CID 142741657) is 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one.
What is the SMILES notation for 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one?
The canonical SMILES for 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one is O=C(c1cnc2c(c1)c(=O)oc1ccc(Cl)cc12)c1ccc2ccccc2c1O.
What is the InChIKey of 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one?
The InChIKey is PADGHJDRSIZXAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12ClNO4/c24-14-6-8-19-17(10-14)20-18(23(28)29-19)9-13(11-25-20)21(26)16-7-5-12-3-1-2-4-15(12)22(16)27/h1-11,27H.
What are the key properties of 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one?
9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one has a molecular weight of 401.81 g/mol, XLogP of 5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-3-(1-hydroxynaphthalene-2-carbonyl)chromeno[4,3-b]pyridin-5-one is sourced from PubChem (CID 142741657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).