C21H25N3O6S — CID 142742047
N-(2,6-dimethoxyphenyl)-N'-[(2R,3S)-3-hydroxyhex-4-yn-2-yl]sulfonyl-5-methylpyridine-3-carbohydrazide (PubChem CID 142742047) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-N'-[(2R,3S)-3-hydroxyhex-4-yn-2-yl]sulfonyl-5-methylpyridine-3-carbohydrazide.
| Compound Name | N-(2,6-dimethoxyphenyl)-N'-[(2R,3S)-3-hydroxyhex-4-yn-2-yl]sulfonyl-5-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 142742047 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-N'-[(2R,3S)-3-hydroxyhex-4-yn-2-yl]sulfonyl-5-methylpyridine-3-carbohydrazide |
| SMILES | CC#C[C@H](O)[C@@H](C)S(=O)(=O)NN(C(=O)c1cncc(C)c1)c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H25N3O6S/c1-6-8-17(25)15(3)31(27,28)23-24(21(26)16-11-14(2)12-22-13-16)20-18(29-4)9-7-10-19(20)30-5/h7,9-13,15,17,23,25H,1-5H3/t15-,17+/m1/s1 |
| InChIKey | JLEPWXNRUUAUMN-WBVHZDCISA-N |
| XLogP | 1.66 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|