About 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine
4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine (PubChem CID 142742082) has the molecular formula C11H16INO2
and a molecular weight of 321.16 g/mol. Its IUPAC name is 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine |
| PubChem CID | 142742082 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine |
| SMILES | C1=CC(OCCN2CCOCC2)=CC=I1 |
| InChI | InChI=1S/C11H16INO2/c1-3-12-4-2-11(1)15-10-7-13-5-8-14-9-6-13/h1-4H,5-10H2 |
| InChIKey | SCEMTQCYUXOXFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine?
The IUPAC name of 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine (CID 142742082) is 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine.
What is the SMILES notation for 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine?
The canonical SMILES for 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine is C1=CC(OCCN2CCOCC2)=CC=I1.
What is the InChIKey of 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine?
The InChIKey is SCEMTQCYUXOXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16INO2/c1-3-12-4-2-11(1)15-10-7-13-5-8-14-9-6-13/h1-4H,5-10H2.
What are the key properties of 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine?
4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine has a molecular weight of 321.16 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1λ3-iodacyclohexa-1,3,5-trien-4-yloxy)ethyl]morpholine is sourced from PubChem (CID 142742082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).