About N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide
N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide (PubChem CID 14274285) has the molecular formula C24H30N4O3
and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide.
Molecular Properties
| Compound Name | N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide |
| PubChem CID | 14274285 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccc2nn(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C24H30N4O3/c1-14(29)10-21(30)25-16-8-9-18-19(13-16)27-28(26-18)20-12-15(23(2,3)4)11-17(22(20)31)24(5,6)7/h8-9,11-13,31H,10H2,1-7H3,(H,25,30) |
| InChIKey | MKOXEPZTRIXCIL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The IUPAC name of N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide (CID 14274285) is N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide.
What is the SMILES notation for N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The canonical SMILES for N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide is CC(=O)CC(=O)Nc1ccc2nn(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3O)nc2c1.
What is the InChIKey of N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The InChIKey is MKOXEPZTRIXCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O3/c1-14(29)10-21(30)25-16-8-9-18-19(13-16)27-28(26-18)20-12-15(23(2,3)4)11-17(22(20)31)24(5,6)7/h8-9,11-13,31H,10H2,1-7H3,(H,25,30).
What are the key properties of N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide?
N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide has a molecular weight of 422.53 g/mol, XLogP of 4.64, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl]-3-oxobutanamide is sourced from PubChem (CID 14274285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).