About 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine
5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine (PubChem CID 142743065) has the molecular formula C16H19BrF2N2S
and a molecular weight of 389.31 g/mol. Its IUPAC name is 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine |
| PubChem CID | 142743065 |
| Molecular Formula | C16H19BrF2N2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine |
| SMILES | NC1=NC=C(CCCCCCc2c(F)cc(Br)cc2F)CS1 |
| InChI | InChI=1S/C16H19BrF2N2S/c17-12-7-14(18)13(15(19)8-12)6-4-2-1-3-5-11-9-21-16(20)22-10-11/h7-9H,1-6,10H2,(H2,20,21) |
| InChIKey | QHKSIZVCIGELTR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine?
The IUPAC name of 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine (CID 142743065) is 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine.
What is the SMILES notation for 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine?
The canonical SMILES for 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine is NC1=NC=C(CCCCCCc2c(F)cc(Br)cc2F)CS1.
What is the InChIKey of 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine?
The InChIKey is QHKSIZVCIGELTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrF2N2S/c17-12-7-14(18)13(15(19)8-12)6-4-2-1-3-5-11-9-21-16(20)22-10-11/h7-9H,1-6,10H2,(H2,20,21).
What are the key properties of 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine?
5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine has a molecular weight of 389.31 g/mol, XLogP of 5.17, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(4-bromo-2,6-difluorophenyl)hexyl]-6H-1,3-thiazin-2-amine is sourced from PubChem (CID 142743065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).