C14H16NO6P — CID 142743075
2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphonan-4-yl)isoindole-1,3-dione (PubChem CID 142743075) has the molecular formula C14H16NO6P and a molecular weight of 325.26 g/mol. Its IUPAC name is 2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphonan-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphonan-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142743075 |
| Molecular Formula | C14H16NO6P |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphonan-4-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCCCOP(=O)(O)O1 |
| InChI | InChI=1S/C14H16NO6P/c16-13-10-6-3-4-7-11(10)14(17)15(13)12-8-2-1-5-9-20-22(18,19)21-12/h3-4,6-7,12H,1-2,5,8-9H2,(H,18,19) |
| InChIKey | DYDRJVTWAYRJKK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|