About 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide
4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide (PubChem CID 142743117) has the molecular formula C12H16FO5P
and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide.
Molecular Properties
| Compound Name | 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide |
| PubChem CID | 142743117 |
| Molecular Formula | C12H16FO5P |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide |
| SMILES | O=P1(O)OCCCCCC(Oc2ccc(F)cc2)O1 |
| InChI | InChI=1S/C12H16FO5P/c13-10-5-7-11(8-6-10)17-12-4-2-1-3-9-16-19(14,15)18-12/h5-8,12H,1-4,9H2,(H,14,15) |
| InChIKey | HRGPDQRWTITMJT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide?
The IUPAC name of 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide (CID 142743117) is 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide.
What is the SMILES notation for 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide?
The canonical SMILES for 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide is O=P1(O)OCCCCCC(Oc2ccc(F)cc2)O1.
What is the InChIKey of 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide?
The InChIKey is HRGPDQRWTITMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FO5P/c13-10-5-7-11(8-6-10)17-12-4-2-1-3-9-16-19(14,15)18-12/h5-8,12H,1-4,9H2,(H,14,15).
What are the key properties of 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide?
4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide has a molecular weight of 290.23 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenoxy)-2-hydroxy-1,3,2λ5-dioxaphosphonane 2-oxide is sourced from PubChem (CID 142743117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).