C24H18N2 — CID 142743500
2-[(1Z,3Z,5Z,7Z)-2-(1H-indol-2-yl)cycloocta-1,3,5,7-tetraen-1-yl]-1H-indole (PubChem CID 142743500) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(1Z,3Z,5Z,7Z)-2-(1H-indol-2-yl)cycloocta-1,3,5,7-tetraen-1-yl]-1H-indole.
| Compound Name | 2-[(1Z,3Z,5Z,7Z)-2-(1H-indol-2-yl)cycloocta-1,3,5,7-tetraen-1-yl]-1H-indole |
|---|---|
| PubChem CID | 142743500 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[(1Z,3Z,5Z,7Z)-2-(1H-indol-2-yl)cycloocta-1,3,5,7-tetraen-1-yl]-1H-indole |
| SMILES | C1=C\C=C/C(c2cc3ccccc3[nH]2)=C(c2cc3ccccc3[nH]2)\C=C/1 |
| InChI | InChI=1S/C24H18N2/c1-2-4-12-20(24-16-18-10-6-8-14-22(18)26-24)19(11-3-1)23-15-17-9-5-7-13-21(17)25-23/h1-16,25-26H/b2-1-,3-1-,4-2-,11-3-,12-4-,19-11+,20-12+,20-19- |
| InChIKey | AJCMRNMBFICYKS-UWMIONBASA-N |
| XLogP | 6.24 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |