C20H19O2PSSi — CID 14274425
5,11-dimethyl-5-phenyl-11-sulfanylidenebenzo[d][1,3,2,6]benzodioxaphosphasilocine (PubChem CID 14274425) has the molecular formula C20H19O2PSSi and a molecular weight of 382.50 g/mol. Its IUPAC name is 5,11-dimethyl-5-phenyl-11-sulfanylidenebenzo[d][1,3,2,6]benzodioxaphosphasilocine.
| Compound Name | 5,11-dimethyl-5-phenyl-11-sulfanylidenebenzo[d][1,3,2,6]benzodioxaphosphasilocine |
|---|---|
| PubChem CID | 14274425 |
| Molecular Formula | C20H19O2PSSi |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 5,11-dimethyl-5-phenyl-11-sulfanylidenebenzo[d][1,3,2,6]benzodioxaphosphasilocine |
| SMILES | C[Si]1(c2ccccc2)c2ccccc2OP(C)(=S)Oc2ccccc21 |
| InChI | InChI=1S/C20H19O2PSSi/c1-23(24)21-17-12-6-8-14-19(17)25(2,16-10-4-3-5-11-16)20-15-9-7-13-18(20)22-23/h3-15H,1-2H3 |
| InChIKey | KCTGHFGXBJJIAA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|