About 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile
4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile (PubChem CID 142744257) has the molecular formula C28H14Cl2N2S2
and a molecular weight of 513.47 g/mol. Its IUPAC name is 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 142744257 |
| Molecular Formula | C28H14Cl2N2S2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(Sc2ccc3ccccc3c2)c(Cl)c(Cl)c1Sc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H14Cl2N2S2/c29-25-26(30)28(34-22-12-10-18-6-2-4-8-20(18)14-22)24(16-32)23(15-31)27(25)33-21-11-9-17-5-1-3-7-19(17)13-21/h1-14H |
| InChIKey | DXLWYUAUEQBLKF-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile (CID 142744257) is 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile is N#Cc1c(C#N)c(Sc2ccc3ccccc3c2)c(Cl)c(Cl)c1Sc1ccc2ccccc2c1.
What is the InChIKey of 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile?
The InChIKey is DXLWYUAUEQBLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H14Cl2N2S2/c29-25-26(30)28(34-22-12-10-18-6-2-4-8-20(18)14-22)24(16-32)23(15-31)27(25)33-21-11-9-17-5-1-3-7-19(17)13-21/h1-14H.
What are the key properties of 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile?
4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile has a molecular weight of 513.47 g/mol, XLogP of 9.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-bis(naphthalen-2-ylsulfanyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 142744257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).